Answer:
Kinetic energy , is the energy of an object possessed due to it's motion
Explanation:
Kinetic energy is the energy of mass in motion. The kinetic energy of an object is the energy it has because of its motion.
it's formula ½mv²
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
It is because the object that is charged attracts the uncharged because it is giving electrons and passing it on to the object. As shown in the image the balloon is attracting the paper that is not charged. Actually telling,the charged object will cause the uncharged object to become charged, with a positive charge on one side and a negative charge on the other side. This process is called induction.
Explanation: Pls Mark Brainliest
Explanation:
The structures of both acetone and propanal are shown below:
In the formula of propanal there is -CHO functional group at the end.
In acetone -CO- group is present in the middle that is on the second carbon.
The molecular formula is C3H6O.
Both have same molecular formula but different structural formulas.
The phenomenon that naturally warms the earth's lower atmosphere and surface is called the greenhouse effect.
Put me as Brainliest!!!
