Water is H2O but I'm not sure about solids.
Answer:
Scientific Method.
Explanation:
A scientific method is basically a method or a process when you conduct an experiment. Normally, the process goes like this:
1. You make like a question or something that you want to investigate, it's like the aim of the experiment.
2. You make an experiment and a hypothesis. A hypothesis is basically a guess on how the results of the experiment would turn out. You don't have to be correct for the hypothesis since there is no right or wrong answer.
3. Conduct the experiment. I don't think this needs a detailed explanation since experiments vary from one another.
4. Collect results. The data you collect come in different ways based on your experiment, but it is crucial you get data so that you can answer your question in 1.
5. Make inferences. You can't directly get a conclusion or answer from the results, so inferences are needed.
6. Craft a conclusion or answer. This is the final step when conducting an experiment and the part where you have the answer you needed when you conducted the experiment :)
1) number of moles of N2 = n/2
2) Number of moles of CH4 = n/2
3) Total number of moles of the mixture = n/2 + n/2 = n
4) Kg of N2
mass in grams = number of moles * molar mass
molar mass of N2 = 2 * 14.0 g/mol = 28 g/mol
=> mass of N2 in grams = (n/2) * 28 = 14n
mass of N2 in Kg = mass of N2 in grams * [1 kg / 1000g] = 14n/1000 kg = 0.014n kg
Answer: mass of N2 in kg = 0.014n kg
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
Explanation:
How many mols do you have?
1 mol = 6.02 * 10^23 atoms
x mol = 6.25 * 10 ^32 atoms
1/x = 6.02*10^23 / 6.25 * 10^32 Cross multiply
6.02 * 10^23 * x = 1 * 6.25 * 10^32 Divide by 6.02 * 10^23
x = 6.25 * 10*32/ 6.02 ^10^23
x = 1.038 * 10^9 mols which is quite large.
Find the number of grams. (Use the value for copper on your periodic table. I will just use an approximate number.)\
1 mol of copper = 63 grams.
1.038 * 10^9 mols of copper = x
1/1.038 * 10^9 = 63/x Cross multiply
x = 1.038 * 10^9 * 63
x = 6.54 * 10^10 grams of copper.
