All categories

2 years ago

What would be the bond order for He 2 2- molecule

Chemistry

1 answer:

LuckyWell [14K]2 years ago

8 0

Answer:

In He2 molecule,

Atomic orbitals available for making Molecular Orbitals are 1s from each Helium. And total number of electrons available are 4.

Molecular Orbitals thus formed are:€1s2€*1s2

It means 2 electrons are in bonding molecular orbitals and 2 are in antibonding molecular orbitals .

Bond Order =Electrons in bonding molecular orbitals - electrons in antibonding molecular orbitals /2

Bond Order =Nb-Na/2

Bond Order =2-2/2=0

Since the bond order is zero so that He2 molecule does not exist.

Explanation:

You might be interested in

What is the solution to the problem expressed to the correct number of significant figures

quester [9]

I don't know what the problem is, but here are some rues to help you out:

All non-zero figures are significant
When a zero falls between non-zero digits, that zero is significant.
When a zero falls after a decimal point, that zero is significant.
When multiplying and dividing significant figures, the answer is limited to the number of sig figs equal to the least number of sig figs in the problem.
When adding and subtracting, the answer is limited to the number of decimal places in the number with the least number of decimal places.

4 0

3 years ago

Never mind jhvjycdtrsesetdfyguhbjnk

OlgaM077 [116]

Complete Question

methanol can be synthesized in the gas phase by the reaction of gas phase carbon monoxide with gas phase hydrogen, a 10.0 L reaction flask contains carbon monoxide gas at 0.461 bar and 22.0 degrees Celsius. 200 mL of hydrogen gas at 7.10 bar and 271 K is introduced. Assuming the reaction goes to completion (100% yield)

what are the partial pressures of each gas at the end of the reaction, once the temperature has returned to 22.0 degrees C express final answer in units of bar

Answer:

The partial pressure of methanol is $P_{CH_3OH_{(g)}} =0.077 \ bar$

The partial pressure of carbon monoxide is $P_{CO} = 0.382 \ bar$

The partial pressure at hydrogen is $P_H = O \ bar$

Explanation:

From the question we are told that

The volume of the flask is $V_f = 10.0 \ L$

The initial pressure of carbon monoxide gas is $P_{CO} = 0.461 \ bar$

The initial temperature of carbon monoxide gas is $T_{CO} = 22.0^oC$

The volume of the hydrogen gas is $V_h = 200 mL = 200 *10^{-3} \ L$

The initial pressure of the hydrogen is $P_H = 7.10 \ bar$

The initial temperature of the hydrogen is $T_H = 271 \ K$

The reaction of carbon monoxide and hydrogen is represented as

$CO_{(g)} + 2H_2_{(g)} \rightarrow CH_3OH_{(g)}$

Generally from the ideal gas equation the initial number of moles of carbon monoxide is

$n_1 = \frac{P_{CO} * V_f }{RT_{CO}}$

Here R is the gas constant with value $R = 0.0821 \ L \cdot atm \cdot mol^{-1} \cdot K$

=> $n_1 = \frac{0.461 * 10 }{0.0821 * (22 + 273)}$

=> $n_1 = 0.19$

Generally from the ideal gas equation the initial number of moles of Hydrogen is

$n_2 = \frac{P_{H} * V_H }{RT_{H}}$

$n_2 = \frac{ 7.10 * 0.2 }{0.0821 * 271 }$

=> $n_2 = 0.064$

Generally from the chemical equation of the reaction we see that

2 moles of hydrogen gas reacts with 1 mole of CO

=> 0.064 moles of hydrogen gas will react with x mole of CO

$x = \frac{0.064}{2}$

=> $x = 0.032 \ moles \ of \ CO$

Generally from the chemical equation of the reaction we see that

2 moles of hydrogen gas reacts with 1 mole of $CH_3OH_{(g)}$

=> 0.064 moles of hydrogen gas will react with z mole of $CH_3OH_{(g)}$

$z = \frac{0.064}{2}$

=> $z = 0.032 \ moles \ of \ CH_3OH_{(g)}$

From this calculation we see that the limiting reactant is hydrogen

Hence the remaining CO after the reaction is

$n_k = n_1 - x$

=> $n_k = 0.19 - 0.032$

=> $n_k = 0.156$

So at the end of the reaction , the partial pressure for CO is mathematically represented as

$P_{CO} = \frac{n_k * R * T_{CO}}{V}$

=> $P_{CO} = \frac{0.158 * 0.0821 * 295}{10}$

=> $P_{CO} = 0.382 \ bar$

Generally the partial pressure of hydrogen is 0 bar because hydrogen was completely consumed given that it was the limiting reactant

Generally the partial pressure of the methanol is mathematically represented as

$P_{CH_3OH_{(g)}} = \frac{z * R * T_{CO}}{V_f}$

Here $T_{CO}$ is used because it is given the question that the temperature returned to 22.0 degrees C

$P_{CH_3OH_{(g)}} = \frac{0.03 * 0.0821 * 295}{10}$

$P_{CH_3OH_{(g)}} =0.077 \ bar$

6 0

2 years ago

Read 2 more answers

Describe two ways in which a cell grows.

adelina 88 [10]

Answer:

There are two types of cell division: mitosis and meiosis. Most of the time when people refer to “cell division,” they mean mitosis, the process of making new body cells.

3 0

2 years ago

How to balance this equation NH4OH+H3PO4=(NH4)3PO4+H2O with explainatio please

Maru [420]

Answer:

3 NH4OH (l) + H3PO4 (aq) → (NH4)3PO4 (aq) + 3 H2O (l)

Explanation:

This is an acid-base reaction (neutralization): NH4OH is a base, H3PO4 is an acid

5 0

1 year ago

Read 2 more answers

An enzyme is: a. A biological reactant b. A biological product c. A biological catalyst d. a biological co-factor

vovangra [49]

It is <span>a substance produced by a living organism that acts as a catalyst to bring about a specific biochemical reaction.
So I think C matches the discription </span>

8 0

2 years ago

Read 2 more answers