Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
The process by which food is broken down to release energy is called respiration
I hope it helps.
I think it’s hydroxybutanal