Answer:
<h3>KBr + I- ---------> KI + Br-</h3>
Explanation:
Single Displacement reaction is a chemical Reaction in which one element in the salt is replaced with another element
for example,
A-B + C -------> A-C + B
electropositive replaces only electropositive elements from compound. same is true for electronegative element
in first reaction I being electro negative replaces Br from KBr so this is a single displacement reaction
Answer:
½O 2 + 2e - + H 2O → 2OH.
Explanation:
Redox reactions - Higher
In terms of electrons:
oxidation is loss of electrons
reduction is gain of electrons
Rusting is a complex process. The example below show why both water and oxygen are needed for rusting to occur. They are interesting examples of oxidation, reduction and the use of half equations:
iron loses electrons and is oxidised to iron(II) ions: Fe → Fe2+ + 2e-
oxygen gains electrons in the presence of water and is reduced: ½O2 + 2e- + H2O → 2OH-
iron(II) ions lose electrons and are oxidised to iron(III) ions by oxygen: 2Fe2+ + ½O2 → 2Fe3+ + O2-
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
T=20 min
m₀=200 g
t=60 min
the mass of element through time t is:
m=m₀*2^(-t/T)
m=200*2^(-60/20)=25 g
25 grams of element will be left after 60 minutes
