Answer:
300 mL
Explanation:
the unit formula of calcium phosphate is Ca3(PO4)2
molar mass of Ca3(PO4)2 = (3×40 + 2×31 + 8×16) g/mol = 310 g/mol
n = m/M = 35 g/(310 g/mol)
c = n/V
V = n/c = [35 g/(310 g/mol)]/0.375 mol/L
V = 0.30 L = 300 mL
Answer:
a) = 0.704%
b) = 1.30%
c) = 2.60%
Explanation:
Given that:
= 
For Part A; where Concentration of A = 0.270 M
Percentage Ionization(∝) 
percentage% (∝) = 
= 0.704%
For Part B; where Concentration of B = 
M
percentage% (∝) = 0.0130 × 100%
= 1.30%
For Part C; where Concentration of C= 
percentage% (∝) = 0.02608 × 100%
= 2.60%
Answer:
CaCO₃(s) → CaO(s) + CO₂(g)
Explanation:
The decomposition reaction always make two compounds from one.
The products always have simpler chemical structure, originated from a determined compound. This can happens spontaneously or by a third party.
A notable example of decomposition is hydrolysis. As for example the case of water, which decomposes and generates oxygen and hydrogen gas
2H₂O (l) → 2 H₂ (g) + O₂ (g)
In this case, the calium carbonate decomposes into CaO and CO₂
These two, are the products of the decomposition.
Of course, the unique reactant is the Calcium Carbonate
The balanced equation is:
CaCO₃(s) → CaO(s) + CO₂(g)
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
I uploaded the answer to a file hosting. Here's link:
tinyurl.com/wtjfavyw
