67.45 is the answer I think
Answer:
Newton's third law of motion states that every action, there is an equal and opposite reaction force and that forces come in pairs
Answer: 23.8889
Explanation:
(75°F − 32) × 5/9 = 23.889°C
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Radioactive decay (also known as nuclear decay, radioactivity, radioactive disintegration or nuclear disintegration) is the process by which an unstable atomic nucleus loses energy by radiation. A material containing unstable nuclei is considered radioactive. Three of the most common types of decay are alpha decay (-decay), beta decay (-decay), and gamma decay (-decay), all of which involve emitting one or more particles or photons. The weak force is the mechanism that is responsible for beta decay, while the other two are governed by the usual electromagnetic and strong forces.[1]
