3 years ago

Explain how stagnant sulfureted water may greatly accelerate metallic corrosion. (See the Email Link in Moodle) | (7 marks)

Chemistry

1 answer:

slavikrds [6]3 years ago

6 0

Answer:

sulfur promotes oxide-reduction reactions.

Explanation:

In stagnant water, some solutes tend to precipitate. When Sulfur precipitate and touch a metal, Sulfur is being reduced and the metal is oxidated. This depends of potential redox of each element.

You might be interested in

1. Marisa determined the melting point of a substance to be 24.5C. Find the percent error of her measurement if the actual melti

USPshnik [31]

Answer:

$\%\ Error = 21.5\%$

Explanation:

Given

$Measured = 24.5$

$Actual = 31.2$

Required

Determine the percentage error

First, we need to determine the difference in the measurement

$Difference = |Actual - Measured|$

$Difference = |31.2 - 24.5|$

$Difference = |6.7|$

$Difference = 6.7$

The percentage error is calculated as thus:

$\%\ Error = \frac{Difference * 100\%}{Actual}$

$\%\ Error = \frac{6.7 * 100\%}{31.2}$

$\%\ Error = \frac{670\%}{31.2}$

$\%\ Error = 21.4743589744\%$

$\%\ Error = 21.5\%$ approximated

6 0

3 years ago

Write the equilibrium expression of each chemical equation. 2H2S(g) 2H2(g) + S2(g)

hodyreva [135]

Answer:

[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2

Explanation:

2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)

The equilibrium constant expression in terms of concentrations is:

Kc=[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2.

6 0

2 years ago

List 2 underlying causes of water pollution

olga_2 [115]

Answer:

industrialization and rapid human population growth.

Explanation:

Hope this helps

6 0

2 years ago

Read 2 more answers

Mammals use their lungs to provide oxygen for themselves from the air. Fish spend a majority of their time in the water, and ins

Elenna [48]

B of course is the answer

7 0

2 years ago

Read 2 more answers

Vehicle emissions devices incorporate a chemical reaction to help control carbon monoxide pollution: 2CO+ O2->2CO2

BigorU [14]

It convert carbon monoxide faster

3 0

3 years ago

Read 2 more answers