Answer:
- def median(l):
- if(len(l) == 0):
- return 0
- else:
- l.sort()
- if(len(l)%2 == 0):
- index = int(len(l)/2)
- mid = (l[index-1] + l[index]) / 2
- else:
- mid = l[len(l)//2]
- return mid
-
- def mode(l):
- if(len(l)==0):
- return 0
-
- mode = max(set(l), key=l.count)
- return mode
-
- def mean(l):
- if(len(l)==0):
- return 0
- sum = 0
- for x in l:
- sum += x
- mean = sum / len(l)
- return mean
-
- lst = [5, 7, 10, 11, 12, 12, 13, 15, 25, 30, 45, 61]
- print(mean(lst))
- print(median(lst))
- print(mode(lst))
Explanation:
Firstly, we create a median function (Line 1). This function will check if the the length of list is zero and also if it is an even number. If the length is zero (empty list), it return zero (Line 2-3). If it is an even number, it will calculate the median by summing up two middle index values and divide them by two (Line 6-8). Or if the length is an odd, it will simply take the middle index value and return it as output (Line 9-10).
In mode function, after checking the length of list, we use the max function to estimate the maximum count of the item in list (Line 17) and use it as mode.
In mean function, after checking the length of list, we create a sum variable and then use a loop to add the item of list to sum (Line 23-25). After the loop, divide sum by the length of list to get the mean (Line 26).
In the main program, we test the three functions using a sample list and we shall get
20.5
12.5
12
Answer:
The PFR is more efficient in the removal of the reactive compound as it has the higher conversion ratio.
Xₚբᵣ = 0.632
X꜀ₘբᵣ = 0.5
Xₚբᵣ > X꜀ₘբᵣ
Explanation:
From the reaction rate coefficient, it is evident the reaction is a first order reaction
Performance equation for a CMFR for a first order reaction is
kτ = (X)/(1 - X)
k = reaction rate constant = 0.05 /day
τ = Time constant or holding time = V/F₀
V = volume of reactor = 280 m³
F₀ = Flowrate into the reactor = 14 m³/day
X = conversion
k(V/F₀) = (X)/(1 - X)
0.05 × (280/14) = X/(1 - X)
1 = X/(1 - X)
X = 1 - X
2X = 1
X = 1/2 = 0.5
For the PFR
Performance equation for a first order reaction is given by
kτ = In [1/(1 - X)]
The parameters are the same as above,
0.05 × (280/14) = In (1/(1-X)
1 = In (1/(1-X))
e = 1/(1 - X)
2.718 = 1/(1 - X)
1 - X = 1/2.718
1 - X = 0.3679
X = 1 - 0.3679
X = 0.632
The PFR is evidently more efficient in the removal of the reactive compound as it has the higher conversion ratio.
Answer:
180 x 60 inches
Width = 60 inches
Length = 180 inches
Explanation:
Given
Let L = Length
W = Width
P = Perimeter
Length = 3 * Width
L = 3W
Perimeter of Brass = 480 inches
P = 480
Perimeter is given as 2(L + W);
So, 2 (L + W) = 480
L + W = 480/2
L + W = 240
Substitute 3W for L; so,
3W + W = 240
4W = 240
W = 240/4
W = 60 inches
L = 3W
L = 3 * 60
L = 180 inches
Answer:
The Python Code for Fibonacci Sequence is :
# Function for nth Fibonacci number
def Fibonacci(n):
if n<0:
print("Incorrect input")
# First Fibonacci number is 0
elif n==0:
return 0
# Second Fibonacci number is 1
elif n==1:
return 1
else:
return Fibonacci(n-1)+Fibonacci(n-2)
# Driver Program
print(Fibonacci(9))
Explanation:
The Fibonacci numbers are the numbers in the following integer sequence.
0, 1, 1, 2, 3, 5, 8, 13, 21, 34, 55, 89, 144, ……..
In mathematical terms, the sequence Fn of Fibonacci numbers is defined by the recurrence relation
Fn = Fn-1 + Fn-2
with seed values
F0 = 0 and F1 = 1.
Answer:
The answer is "828.75"
Explanation:
Please find the correct question:
For W21x93 BEAM,
For A992 STREL,
Check for complete section:
Design the strength of beam =
