1) Nuclear reactions involve a change in an atom's nucleus, usually producing a different element. Chemical reactions, on the other hand, involve only a rearrangement of electrons and do not involve changes in the nuclei. ... (3) Rates of chemical reactions are influenced by temperature and catalysts.
Answer:
3
Explanation:
third answer might be right
Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
there's no picture here but I guess the answer would be:
considering the constant temperature, if you double the volume, the pressure would be halved.
like: volume is 2, pressure is 4
if 2×2, then:4÷2
Answer:
Explanation:
In organic chemistry, the reaction between 2-butanol with TsCl and Et3N is known as the tosylation of the alcohol hydroxyl group. Alcohol is being changed to tosylate by the use of tosyl chloride under the influence of a base. Tosylation of alcohol is an example of a nucleophilic substitution reaction. From the image attached below, we will see how the reaction between 2-butanol proceed into the product by using tosyl chloride and a base(Et3N).