Answer:
The answer is A. Cohesion
Explanation:
The reason is for them to be able to stick together.
Answer:
Gas
Explanation:
The process in which a gas changes to a liquid is called condensation. Other examples of condensation are shown in Figure below. A gas condenses when it is cooled below its boiling point. At what temperature does water vapor condense?
The pressure of a gas is the force that a gas exerts per unit area of the container.
Pressure is defined as force per unit area. Gas molecules are constantly colliding against the walls of the container. The pressure of the gas is the force the gas is exerting on its container.
Since temperature is defined as the average kinetic energy of the molecules of a gas then the higher the temperature, the faster the particles move.
The volume of a container refers the size if the container.
The pressure of a gas is inversely proportional to its volume according to Boyle's law. Thus implies that if the pressure of the gas goes up, the volume has to go down.
For a compound to be called an acid, it must contain H+ and H3O+ when dissolved in water.
For a compound to be called a base, the compound must dissolve in water to yield hydroxide ions.
Learn more: brainly.com/question/11543614
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543