Due to hydrogen bonding there is a formation of cage like structure called lattice in ice due to which <span> density of ice is less than that of water. Moreover, it is a known fact that density of water is maximum at 4°C.</span>
Answer:
An atom consists of a positively charged nucleus, surrounded by one or more negatively charged particles called electrons. The positive charges equal the negative charges, so the atom has no overall charge; it is electrically neutral.
Answer:
1.44 x 10²⁵ ions of Na⁺
Explanation:
Given parameters:
Mass of NaCl = 1.4kg = 1400g
Unknown:
Number of ions of sodium = ?
Solution:
The compound NaCl in ionic form can be written as;
NaCl → Na⁺ + Cl⁻
In 1 mole of NaCl we have 1 mole of sodium ions
Now, let us find the number of moles in NaCl;
Number of moles = 
Molar mass of NaCl = 23 + 35.5 = 58.5g/mol
Number of moles = 
= 23.93mol
So;
Since 1 mole of NaCl gives 1 mole of Na⁺
In 23.93 mole of NaCl will give 23.93 mole of Na⁺
1 mole of a substance = 6.02 x 10²³ ions of a substance
23.93 mole of a substance = 6.02 x 10²³ x 23.93
= 1.44 x 10²⁵ ions of Na⁺
valance electrons that reside in the outermost shell of an atom in the highest energy level. They are important to atoms because the fewer valence electrons that the atom holds, it becomes less stable.
I take honors chemistry I hope this helps.
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
