1)Identify the atoms that are participating in a covalent bond.
2)Draw each atom by using its element symbol. The number of valence electrons is shown by placing up to two dots on each side of the element symbol, with each dot representing a single valence electron.
3)Predict the number of covalent bonds each atom will make using the octet rule.
4)Draw the bonding atoms next to each other, showing a single covalent bond as either a pair of dots or a line representing a shared valence electron pair. If the molecule forms a double or triple bond, use two or three lines to represent the shared electron pairs, respectively.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
When calcium carbonate reacts with hydrogen chloride, it reacts to form calcium chloride, carbon dioxide, and water. If this reaction occurs with 51.6% yield, what mass of carbon dioxide will be collected if 16.93 g of CaCO3 is added to sufficient hydrogen chloride
Answer:
It means that the paramecium would be able to better control/regulate algae, bacteria, and other protists that can be found in water.
Explanation:
Physical change does not make a new chemical/object. A chemical change does.
Chemical Change example: Combining liquid and liquid to create a new substance