mechanism, in mechanical construction, the means employed to transmit and modify motion in a machine or any assemblage of mechanical parts.
Answer:
First you have to separate real and imaginary parts of Tan(x+iy)=Tan(z)=sin(z)/cos(z)
sinz=sin(x+iy)=sinxcos(iy)+cosxsin(iy)=sinxcoshy-icosx sinhy
cosz=cos(x+iy)=cosxcos(iy)-sinxsin(iy)=cosxcoshy−isinxsinhy
Now if you plug in Tan(z) and simplify (it is easy!) you get
Tan(z)=(sin(2x)+isinh(2y))/(cos(2x)+cosh(2y))= A+iB.
This means that
A=sin(2x)/(cos(2x)+cosh(2y)) and B= sinh(2y)/(cos(2x)+cosh(2y))
Now,
A/B=sin(2x)/sinh(2y)
If any questions, let me know.
Answer:
Option E
Explanation:
All the given statements are true except the velocity gradients normal to the flow direction are small since these are not normally small. It's true that viscous effects are present only inside the boundary layer and the fluid velocity equals the free stream velocity at the edge of the boundary layer. Moreover, Reynolds number is greater than unity and the fluid velocity is zero at the surface of the object.
Answer:
hope this helps
Explanation:
answers:
1. Chemical engineering is most difficult because it's a mix of physics, chemistry and math
2. Stoichiometry is so important because it shows how materials react, interact and play off each other
3. Yes I think consumers would notice if process control standards were not met. for example medicines, when people take Tylenol or cold pills, if the amount of time it took to kick it becomes longer, people will become aware that the product is not consistent and reliable.
4. i have no idea sorry :(
5. This is explaining how there are rules and regulations to make the workplace safe. it can be accomplished by following those rules and regulations
