Since orbital period depends on how far you are from the sun, planets closer to the sun have a orbital period less than one earth year.
These planets are Mercury and Venus
1) Temperature (heat) of the solution
2) Concentration (amount) of both solvent (usually water) and solute (substance being dissolved by solvent)
3) Movement (kinetic energy) of the solution, as in shaking/stirring
Answer: Ammonia (NH3) and sodium carbonate (Na2CO3), because they accept hydrogen ions but lack hydroxide ions.
Explanation:
i took the test and got it correct :) hope this helps
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
