Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
The replacing of sodium hydroxide with potassium hydroxide
(KOH) to the reaction will least affect the organic product that forms.
Potassium hydroxide is an
inorganic compound with the formula KOH, and is commonly called caustic potash. Along with sodium hydroxide, this colorless
solid is a prototypical strong base.
The first compound C6H12 is cyclohexane and the other compound C6H6 is benzene. They are both aromatic compounds. Cyclohexane does not have double bonds in its ring while benzene has three double bonds in its ring. This is why the formula for cyclohexane contains 12 carbon atoms while benzene only has 6.
Answer:
C
Explanation:
Plants help in carbon dioxode reduction so plants uses atmospheric carbon dioxide and water to produce sugars and oxygen.
HOPE ITS HOPEFUL.
Answer:
Explanation:
Electronegativity is a measure of the ability of an atom to attract the electrons when the atom is part of a compound. Electronegativity values generally increase from left to right across the periodic table. The highest electronegativity value is for fluorine.
