Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
Average atomic mass = 51.9963 amu
Explanation:
Given data:
Abundance of Cr⁵⁰ with atomic mass= 4.34%
, 49.9460 amu
Abundance of Cr⁵² with atomic mass = 83.79%, 51.9405 amu
Abundance of Cr⁵³ with atomic mass =9.50%, 52.9407 amu
Abundance of Cr⁵⁴ with atomic mass = 2.37%, 53.9389 amu
Average atomic mass = 51.9963 amu
Solution:
Average atomic mass = (abundance of 1st isotope × its atomic mass) +(abundance of 2nd isotope × its atomic mass +....n) / 100
Average atomic mass = (4.34×49.9460)+(83.79×51.9405) +(9.50×52.9407)+ (2.37×53.9389) / 100
Average atomic mass = 216.7656 + 4352.0945 + 502.9367 +127.8352 / 100
Average atomic mass = 5199.632 / 100
Average atomic mass = 51.9963 amu
Answer:
a. Dipole-dipole bonding
Explanation:
SO2 has dipole-dipole bonding. This is because of the difference in the electronegativities of Sulphur and oxygen. Moreover, the lone pair of electrons on S gives it bent shape with a net dipole unlike CO2 which has a linear shape.( This why CO2 does not have any dipole moment).
So, the correct answer is a.
Answer:
occur if two of the ions form an insoluble ionic compound, which precipitates out of solution
Explanation:
When two ionic compounds are dissolved in water, a double replacement reaction takes place if two of the ions form an insoluble ionic compound, which precipitates out of solution. In double displacement reaction ions switch partners. And hence, produce an insoluble precipitate.
