Answer:
Its known as static electricity
Answer:
molecular weight of NH3 or grams This compound is also known as Ammonia. The SI base unit for amount of substance is the mole. 1 mole is equal to 1 moles NH3, or 17.03052 grams.
Answer:
The answer to your question is
4C₇H₁₇ + 45 O₂ ⇒ 28 CO₂ + 34H₂O
Explanation:
Write the equation
C₇H₁₇ + O₂ ⇒ CO₂ + H₂O
Process
1.- Check if the equation is balanced
Reactants Element Products
7 C 1
17 H 2
2 O 3
As the number of reactants and products is different, we conclude that the reaction is unbalanced.
2.- Write a coefficient "7" to CO₂ and a coefficient of 17/2 to H₂O
C₇H₁₇ + O₂ ⇒ 7CO₂ +
H₂O
Reactants Element Products
7 C 7
17 H 17
2 O 51/2
3.- Write a coefficient of 45/2 to the O₂, and multiply all the equation by 2.
4C₇H₁₇ + 45 O₂ ⇒ 28 CO₂ + 34H₂O
Reactants Element Products
28 C 28
68 H 68
90 O 90
The correct answer for the question that is being presented above is this one: "<span>0.3."
Here it is how to solve.
M</span><span>olecular mass of Ar = 40
</span><span>Molecular mass of Ne = 20
</span><span>Number of moles of Ar = 9.59/40 = 0.239
</span><span>Number of moles of Ne = 11.12/20= 0.556
</span><span>Mole fraction of argon = 0.239/ ( 0.239 + 0.556) = 0.3</span><span>
</span>
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.