Hi,
Homogeneous mixture 2
Heterogeneous 3
Mixture 1
Solution 5
Compound 4
As you move around there is a change in: electronegativies, ionisation energies, atomic radius etc. different amounts of these properties are going to effect how the element acts
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
They can change properties completely
They can be separated
They form a new set of elements and compounds
<span>The elements become part of the original compounds</span>
Ionic compound is formed by negative and positive ions, these ions form ionic bond
