Answer:
Explanation:
4NH₃ (g) + 3O₂ (g) ⇒ 2N₂ (g) + 6H₂ O(1)
Δ
ΔH r =(2ΔH f(N 2 )+6ΔH f (H 2 O(l)))−(4ΔH f (NH 3 (g))+3ΔH f (O 2 (g)))
ΔH rex =[2×0+6×(−286)]−[4×(−46)+3×0]=−1716+186
ΔH rex =−1532kJ/mol
Thermodynamics is a branch of physical chemistry that studies heat and its effects and interactions. Governed by the four main laws, thermodynamics plays a huge role in physics and chemistry, and is also responsible for the law of conservation of energy, a fundamental rule in science.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Examples of what can be found in each layer of the atmosphere