Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
Two electrons fit in the first shell out from the nucleus and eight fit in the second. Every element with more protons than the two of Helium needs to work on shells outside the first one. one you get to ten, you have filled the first two shells.
In a water molecule, oxygen forms one covalent bond with EACH of TWO hydrogen atoms. As a result, the oxygen atom has a stable arrangement of 8 valence electrons. Each hydrogen atom forms only one bond because it needs only two electrons to be stable.
Answer:
<u>Oxidation state of Mn = +4</u>
Explanation:
Atomic mass of Mn = 55g/mol
From Faraday's law of electrolysis,
Electrochemical equivalent = 
i.e Z =
=
= 0.0001424 g/C
But Equivalent weight, E = atomic mass ÷ valency = Z × 96,485
⇒
= 0.0001424 × 96,485
<u>∴ Valency of Mn = +4</u>
Leftover: approximately 11.73 g of sulfuric acid.
<h3>Explanation</h3>
Which reactant is <em>in excess</em>?
The theoretical yield of water from Al(OH)₃ is lower than that from H₂SO₄. As a result,
- Al(OH)₃ is the limiting reactant.
- H₂SO₄ is in excess.
How many <em>moles</em> of H₂SO₄ is consumed?
Balanced equation:
2 Al(OH)₃ + 3 H₂SO₄ → Al₂(SO₄)₃ + 6 H₂O
Each mole of Al(OH)₃ corresponds to 3/2 moles of H₂SO4. The formula mass of Al(OH)₃ is 78.003 g/mol. There are 15 / 78.003 = 0.19230 moles of Al(OH)₃ in the five grams of Al(OH)₃ available. Al(OH)₃ is in excess, meaning that all 0.19230 moles will be consumed. Accordingly, 0.19230 × 3/2 = 0.28845 moles of H₂SO₄ will be consumed.
How many <em>grams</em> of H₂SO₄ is consumed?
The molar mass of H₂SO₄ is 98.076 g.mol. The mass of 0.28845 moles of H₂SO₄ is 0.28845 × 98.076 = 28.289 g.
How many <em>grams</em> of H₂SO₄ is in excess?
40 grams of sulfuric acid H₂SO₄ is available. 28.289 grams is consumed. The remaining 40 - 28.289 = 11.711 g is in excess. That's closest to the first option: 11.73 g of sulfuric acid.
Answer:
Mass of lava is 8370 g.
Explanation:
Density:
Density is equal to the mass of substance divided by its volume.
Units:
SI unit of density is Kg/m3.
Other units are given below,
g/cm3, g/mL , kg/L
Formula:
D=m/v
D= density
m=mass
V=volume
Symbol:
The symbol used for density is called rho. It is represented by ρ. However letter D can also be used to represent the density.
Given data:
density of lava = 3.1 g/cm³
volume= 2700 cm³
mass= ?
Solution:
d = m/v
m = d×v
m = 3.1 g/cm³×2700 cm³
m = 8370 g