The answer would possible be letter a
Answer:
The O atom will tend to attract the electrons.
Explanation:
The electronegativity of O (3.5) is much higher than H (2.1), which means it is more likely to attract electrons. The higher the electronegativity, the more attractive.
Answer:
polyatomic, ionic
Explanation:
unit that contains two or more atoms covalently bonded together but that has an overall charge is called a(n) polyatomic ion. Many ionic compounds contain such units.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.