Answer:
a) is correct.......,.....
You forgot to attach the question…
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
The organic compounds that are divided into two types, simple and complex, are called carbohydrates.
Carbohydrates are diveded into twy types: simple and complex (starches, fiber, glycogen).
Simple carbohydrates are made of one (monosaccaharides) or two sugar units.
Complex carbohydrates are made up of many sugar units.
For example, glucose (C₆H₁₂O₆) is a simple carbohydrate.
Glucose is chemical compound composed of six carbon atoms, twelve hydrogen atoms and six oxygen atoms.
Starch is a polymeric carbohydrate consisting of a large number of glucose units bonded by glycosidic bond. Starch is a white, tasteless and odorless powder that is insoluble in cold water or alcohol.
More about carbohydrates: brainly.com/question/20290845
#SPJ4
According to an article dated back in February 8, 1992 which is entitled, “Science: Stardust is made of diamonds” on a website called newscientist (https://www.newscientist.com/article/mg13318073-000-science-stardust-is-made-of-diamonds/), American astronomers believed that diamonds are made in supernova explosions. It was said that the diamonds were the foundation of uncommon combinations of isotopes found in some meteorites. Donald Clayton of Clemson University in South Carolina suggested that the weightiest isotopes were more common in meteorites for the reason that the rare gases shaped in the neutron-rich outcome of a supernova explosion. Clayton also said, “the observed mixture of isotopes could have been produced only during the collapse of a massive star to form a neutron star”. This happens in a Type II explosion, for example the Supernova 1987A in the Large Magellanic Cloud. And rare gases like xenon become stuck in both weighty and light isotopes after the ejected gas from such a supernova cools down enough to create dust. The existence of the diamonds with these unusual gases in meteorites infers an alike source. Some of the carbon in the supernova fragments produces ordinary graphite dust, whereas some produces diamond dust. Considerable amount of stardust may be made of diamonds, if Clayton was not mistaken.