None of the above?
(Is there any statements?)
Using the chart that has been provided, we may determine water temperature. We do this by drawing a straight line form the bottom scale which has the ppm of oxygen dissolved to the middle scale which has the percentage saturation.
The line starts from 11.5 ppm on the bottom scale and goes to 90% on the middle scale. Next, we continue this line, without changing its slope, to the third scale showing temperature. We see that it crosses the temperature scale at 4°C.
The temperature of the water is 4 °C.
C: 12.0107 g/mol ≅ 12.00 g/mol
H: 1.00784 g/mol ≅ 1.008 g/mol
O: 15.999 g/mol ≅ 16.00 g/mol
n(molar mass of CH2O)= 180
n.30=180
n=6
molecular formula: c6h12o6 glucose
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
