Halogens is defined as the group of 7 periodic table. As, every periodic table contains 7 valence electrons and they only need 1 more to complete an outer shell, that is why they are extremely reactive. And according to the law that recurring patterns of the properties of elements arise when they are arranged in order of increasing atomic number. As the halogen all act very similarly with each other in chemical reaction, it is true.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
Curbing global carbon dioxide emissions has been a challenge, primarily because they are being driven higher by countries with low per capita emissions.
Explanation:
"just trust me bro"
There is thermal energy, but temperature is also a measure of the average kinetic energy, so either of those should be acceptable answers for the question.
Answer:
5
Explanation:
To balance the hydrogen atoms, we check the number of hydrogen on the left side, this is equal to the 10 hydrogen atoms we have in the alkanol.
Now, on the right hand side, we can see we only have two hydrogen atoms in the water molecule. Now, to make equal the number of hydrogen atoms on both sides, we simply multiply the number of hydrogen there by 5 to make it 10 too