I’m not sure if there was important information in the question before this one, but the answer based on the info I have is B.
The density of water is 1kg/L. Since the density of the block is less, it will float.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
992.302 K
Explanation:
V(rms) = 750 m/s
V(rms) = √(3RT / M)
V = velocity of the gas
R = ideal gas constant = 8.314 J/mol.K
T = temperature of the gas
M = molar mass of the gas
Molar mass of CO₂ = [12 + (16*2)] = 12+32 = 44g/mol
Molar mass = 0.044kg/mol
From
½ M*V² = 3 / 2 RT
MV² = 3RT
K = constant
V² = 3RT / M
V = √(3RT / M)
So, from V = √(3RT / M)
V² = 3RT / M
V² * M = 3RT
T = (V² * M) / 3R
T = (750² * 0.044) / 3 * 8.314
T = 24750000 / 24.942
T = 992.302K
The temperature of the gas is 992.302K
Note : molar mass of the gas was converted from g/mol to kg/mol so the value can change depending on whichever one you use.
Answer:
The energy released as heat when 9.94 g Cu 2 O ( s ) undergo oxidation at constant pressure is -10.142 kJ
Explanation:
Here we have
2Cu₂O ( s ) + O₂ ( g ) ⟶ 4 CuO ( s ) Δ H ∘ rxn = − 292.0 kJ mol
In the above reaction, 2 Moles of Cu₂O (copper (I) oxide) react with one mole of O₂ to produce 4 moles of CuO, with the release of − 292.0 kJ/mol of energy
Therefore,
1 Moles of Cu₂O (copper (I) oxide) react with 0.5 mole of O₂ to produce 2 moles of CuO, with the release of − 146.0 kJ of energy
We have 9.94 g of Cu₂O with molar mass given as 143.09 g/mol
Hence the number of moles in 9.94 g of Cu₂O is given as
9.94/143.09 = 6.95 × 10⁻² moles of Cu₂O
6.95 × 10⁻² moles of Cu₂O will therefore produce 6.95 × 10⁻² × − 146.0 kJ mol or -10.142 kJ.
