<span>1=H, 2=B, 3=F, 4=A,5=C,6=E, 7=D, 8=G
</span>9: 69Ga=60.12% and 71Ga=39.88%; total=69.797amu
10: 27 27.977 92.23; 28 28.976 4.67; 29 29.974 3.10; abundance =28.07 Silicon
I hope this helps!
<u>Answer:</u> The molecular weight of protein is 
<u>Explanation:</u>
To calculate the concentration of solute, we use the equation for osmotic pressure, which is:
or,
where,
= Osmotic pressure of the solution = 0.0861 atm
i = Van't hoff factor = 1 (for non-electrolytes)
= mass of protein = 400 mg = 0.4 g (Conversion factor: 1 g = 1000 mg)
= molar mass of protein = ?
= Volume of solution = 5.00 mL
R = Gas constant = 
T = temperature of the solution = ![25^oC=[25+273]K=298K](https://tex.z-dn.net/?f=25%5EoC%3D%5B25%2B273%5DK%3D298K)
Putting values in above equation, we get:
Hence, the molecular weight of protein is
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
<span>if given element is neutral, than it has to have same number of protons and electrons. so in this case it is 12 electrons.</span><span>
Hope it helps :)
</span>
Most renewable<span> energy comes either directly or indirectly from the </span>sun<span>. </span>Sunlight<span>, or solar energy, can be used directly for heating and lighting homes and other buildings, for generating electricity, and for hot water heating, solar cooling, and a variety of commercial and industrial uses.
</span>
