Answer:
The answer to your question is Q = 18702.5 J
Explanation:
Data
mass of water = m = 447 g
Cp = 4.184 J/g°C
Temperature 1 = T1 = 25°C
Temperature 2 = T2 = 35°C
Heat = Q = ? Joules
Process
1.- Write the formula to calculate heat
Q = mCp(T2 - T1)
2.- Substitution
Q = (447)(4.184)(35 - 25)
3.- Simplification
Q = (447)(4.184)(10)
4.- Result
Q = 18702.5 J
Answer:
a=28600J; b=90.6 J/K; c=402 torr
Explanation:
(a) considering the data given
Vapour pressure P1 =0 at Temperature T1 = 42.43˚C,
Vapour pressure P2 = 273.15 at Temperature T2= 315.58 K)
Using the Clausius-Clapeyron Equation
ln (P2/P1) = (ΔH/R)(1/T2 - 1/T1)
In 760/140 = ΔH/8.314 J/mol/K × (1/315.58K -- 1/273.15K)
ΔH vap= +28.6 kJ/mol or 28600J
(b) using the Equation ΔG°=ΔH° - TΔS to solve forΔS.
Since ΔG at boiling point is zero,
ΔS =(ΔH°vap/Τb)
ΔS = 28600 J/315.58 K
= 90.6 J/K
(c) using ln (P2/P1) = (ΔH/R)(1/T2 - 1/T1)
ln P298 K/1 atm = 28600 J/8.314 J/mol/K × (1/298.15K - 1/315.58K)
P298 K = 0.529 atm
= 402 torr
A fusion reaction can be regarded as the type of reaction that occurs where two lighter elements come together in a type of reaction giving rise to a heavier/more massive element.
A fusion reaction always creates a more massive atomic nucleus (option c).
When the two lighter nuclei comes together in a reaction, a more heavier/massive nucleus is formed but its mass will still be less than the combined mass of the two reactant nuclei.
This also indicates that the left over mass may have been released as energy.
Learn more: brainly.com/question/18175586
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
