Answer:
Q = 270 Joules (2 sig. figs. as based on temperature change.)
Explanation:
Heat Transfer Equation of pure condensed phase substance => Q = mcΔT
Mixed phase (s ⇄ l melting/freezing, or l ⇄ g boiling/condensation) heat transfer equation => Q = m∙ΔHₓ; ΔHₓ = phase transition constant
Since this is a pure condensed phase (or, single phase) form of lead (Pb°(s)) and not melting/freezing or boiling/condensation, one should use
Q = m·c·ΔT
m = mass of lead = 35.0g
c = specific heat of lead = 0.16J/g°C
ΔT = Temp change = 74°C - 25°C = 49°C
Q = (35.0g)(0.16J/g·°C )(49°C) = 274.4 Joules ≅ 270 Joules (2 sig. figs. as based on temperature change.)
Carbon dioxide is created when hydrolic is mixed with calcium carbonate.
Answer:
Polymerization.
Explanation:
Polymerization can be defined as a type of chemical reaction in which molecules that are relatively small in size chemically combine to form a huge chain of molecules.
Simply stated, polymerization refers to a chemical reaction where two or more smaller molecules react to produce larger molecules of the same network or repetitive structural units.
In polymerization, the relatively small molecules are generally referred to as monomers while the larger molecules they produce are known as polymers.
Polymerization is given by the chemical formula;
nA -----> A(n).
In this scenario, Luis uses a stencil to repeat the same design on each wall to form one long grapevine with a bunch of grapes every foot along its length.
Hence, the type of chemical reaction this best model is polymerization because it involved repeating the same design (monomers) to form a long grapevine with a bunch of grapes (polymers).
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Mexican Texas<span> is the historiographical name used to refer to the era of </span>Texan<span> history between 1821 and 1836, </span>when it was part<span> of </span>Mexico<span>. </span>Mexico gained independence<span> from Spain in 1821 in </span>its war<span> of</span>independence<span>. Initially, </span>Mexican Texas<span> operated very similarly to Spanish </span>Texas<span>.</span>
