Answer:
C: Sodium chloride
Explanation:
Common salt is gotten when sodium atoms reacts with chlorine atoms in an exothermic reaction to form an ionic substance known as sodium chloride with the chemical formula NaCl.
Equation is;
2Na + Cl2 = 2NaCl
Looking at the options, the correct one is Sodium chloride.
The answer is solution a must have a lower solute concentration than solution b.
That is when water is moving across a membrane from solution a into solution b, then solution a must have a lower solute concentration than solution b.
When solution a have a lower solute concentration than solution b, then water moves across a membrane from solution a into solution b.
A is the answer
Hope it helps :)
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>