Which atom in the O-F bond has a partial positive charge (δ⁺)?

In hydrate ratio does the mass of salt come first or does the mass of water

frutty [35]

CuSO4 *5H20
In the formula of the hydrate, on the first place is the salt and on the second of water. so in ration on the first place should be salt also.

6 0

3 years ago

State one type of additional information that could be used to determine if these three species are closely related.

Luda [366]

Answer:

Study the bone structure of limbs.

Explanation:

Study the bone structure of limbs can be used to find out the relatedness and relationship among three species because the pattern of bones structure is similar but the structure is different from one another due to different environmental conditions. This study provides important and useful information whether the three species are closely related or not. If they have similar bone structure than we can say that there are more chances that they are closely related to each other.

5 0

2 years ago

31. Adding an additional oxygen atom to 02 creates....

cricket20 [7]

It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs

4 0

2 years ago

Aluminum reacts with sulfur gas to produce aluminum sulfide. a) What is the limiting reactant? What is the excess reagent? b) Ho

Sophie [7]

Answer:

a) Limiting: sulfur. Excess: aluminium.

b) 1.56g Al₂S₃.

c) 0.72g Al

Explanation:

Hello,

In this case, the initial mass of both aluminium and sulfur are missing, therefore, one could assume they are 1.00 g for each one. Thus, by considering the undergoing chemical reaction turns out:

$2Al(s)+3S_2(g)\rightarrow 2Al_2S_3(s)\\$

a) Thus, considering the assumed mass (which could be changed based on the one you are given), the limiting reagent is identified as shown below:

$n_S^{available}=1.00gS_2*\frac{1molS_2}{64gS_2} =0.0156molS_2\\n_S^{consumed\ by \ Al}=1.00gAl*\frac{1molAl}{27gAl}*\frac{3molS_2}{2molAl}=0.0556molS_2$

Thereby, since there 1.00g of aluminium will consume 0.0554 mol of sulfur but there are just 0.0156 mol available, the limiting reagent is sulfur and the excess reagent is aluminium.

b) By stoichiometry, the produced grams of aluminium sulfide are:

$m_{Al_2S_3}=0.0156molS_2*\frac{2molAl_2S_3}{3molS_2} *\frac{150gAl_2S_3}{1molAl_2S_3} =1.56gAl_2S_3$

c) The leftover is computed as follows:

$m_{Al}^{excess}=(0.0556-0.0156)molS_2*\frac{2molAl}{3molS_2}*\frac{27gAl}{1molAl} =0.72 gAl\\$

NOTE: Remember I assumed the quantities, they could change based on those you are given, so the results might be different, but the procedure is quite the same.

Best regards.

7 0

2 years ago

2. Hydrogen gas at a temperature of 22.0°C that is confined in a 5.00L cylinder exerts a pressure of 4.20atm. If the gas is rele

Umnica [9.8K]

Answer: n∗R=22+273.15/4.2∗5n

P2=n∗R∗T2/V2=n∗R∗33.6+273.15/10

Explanation:

4 0

2 years ago