Answer:
1.1 percent
Explanation:
C6H5COOH⇌C6H5COO+H
Ka = [C6H5COO-][H+]/[C6H5COOH]
From pKa of 4.2, Ka = 6.3x10^-5
6.3x10^-5 = (x)(x)/0.51-x and assuming x is small...
6.3x10^-5 = x^2/0.51
x^2 = 3.213x10^-5
x =5.67 x10^-3
(5.67x10^-3/0.51)x 100 =1.1 percent
The dependent variable depends on the independent variable
Answer: sodium metal and chlorine gas
Explanation:
Answer is B can you like btw??
<h2>Answer:</h2>
Plasma
<h2>Explanation:</h2>
Plasma is the stuff of lightning, flame and stars. Plasma is neither solid, liquid nor gas plasma is a fourth state of matter.
Plasma is when the electrons are "freed" from their host atoms for a short time, due to high temperatures. Fire is plasma, it responds to electric fields. Lightning is also plasma.
