Pb(NO3)2+K2CrO4=PbCrO4+KNO3 reaction type

A 825 g iron block is heated to 352 degrees C and is placed in an insulated container (of negligible heat capacity) containing 4

Stella [2.4K]

Answer : The final equilibrium temperature of the water and iron is, 537.12 K

Explanation :

In this problem we assumed that heat given by the hot body is equal to the heat taken by the cold body.

$q_1=-q_2$

$m_1\times c_1\times (T_f-T_1)=-m_2\times c_2\times (T_f-T_2)$

where,

$c_1$ = specific heat of iron = 560 J/(kg.K)

$c_1$ = specific heat of water = 4186 J/(kg.K)

$m_1$ = mass of iron = 825 g

$m_2$ = mass of water = 40 g

$T_f$ = final temperature of water and iron = ?

$T_1$ = initial temperature of iron = $352^oC=273+352=625K$

$T_2$ = initial temperature of water = $20^oC=273+20=293K$

Now put all the given values in the above formula, we get:

$(825\times 10^{-3}kg)\times 560J/(kg.K)\times (T_f-625K)=-(40\times 10^{-3}kg)\times 4186J/(kg.K)\times (T_f-293K)$

$T_f=537.12K$

Therefore, the final equilibrium temperature of the water and iron is, 537.12 K

8 0

2 years ago

The chemical equation below shows the burning of magnesium (Mg) with oxygen (O2) to form magnesium oxide

scoundrel [369]

Answer:

64

Explanation:

B

4 0

2 years ago

The natural abundances of elements in the human body, expressed as percent by mass, are: oxygen (O),65 percent; carbon (C), 18 p

almond37 [142]

Answer:

The mass in grams of each element in the body of 62 Kg are

Oxygen 40300 g

Carbon 11160 g

Hydrogen 6200 g

Nitrogen 1860 g

Calcium 992 g

Phosphorus 744 g

Other elements 744 g

It is possible to check it adding all the components, the total is 62000 g.

Explanation:

Firstly, we have a total mass of 62 Kg and the composition as a percentage of each component.

Percentage ( %)

Oxygen 65.0

Carbon 18.0

Hydrogen 10.0

Nitrogen 3.0

Calcium 1.6

Phosphorus 1.2

Other elements 1.2

Taking the definition of a percentage as part of hundred total, each percentage can be expressed as a decimal number. We should divide the percentage with 100 of total. For example: Oxygen 65%, it means 65/100 = 0.65. So, Oxygen is 0.65 in decimal numbers. We do the same for each component.

Percentage ( %) Decimal number

Oxygen 65.0 65/100 = 0.65

Carbon 18.0 18/100 = 0.18

Hydrogen 10.0 10/100 = 0.10

Nitrogen 3.0 3/100 = 0.03

Calcium 1.6 1.6/100 = 0.016

Phosphorus 1.2 1.2/100 = 0.012

Other elements 1.2 1.2/100 = 0.012

Finally. We can multiply decimal number of each component taking the total. 1 Kg is equivalent to 1000 g.

So, 62 Kg = 62 * 1000 g = 62000 g

After that we get the mass in grams of each element, by multiplying 62000 g and the decimal number of each component as follows:

Percentage ( %) Decimal number Mass in grams (g)

Oxygen 65.0 65/100 = 0.65 0.65*62000=40300

Carbon 18.0 18/100 = 0.18 0.18*62000= 11160

Hydrogen 10.0 10/100 = 0.10 0.10*62000= 6200

Nitrogen 3.0 3/100 = 0.03 0.03*62000= 1860

Calcium 1.6 1.6/100 = 0.016 0.016*62000= 992

Phosphorus 1.2 1.2/100 = 0.012 0.012*62000=744

Other elements 1.2 1.2/100 = 0.012 0.012*62000=744

5 0

3 years ago

Answer this, please!!!!!!!!!!

mixer [17]

Answer:

It's C

Explanation:

Most garnet found near Earth's surface forms when a sedimentary rock with a high aluminum content, such as shale, is subjected to heat and pressure intense enough to produce schist or gneiss.

5 0

2 years ago

Read 2 more answers

The primary source of chemical energy in the body is

scZoUnD [109]

ATP synthesis in human cells and energy metabolism.

6 0

2 years ago

Pb(NO3)2+K2CrO4=PbCrO4+KNO3 reaction type​

Pb(NO3)2+K2CrO4=PbCrO4+KNO3 reaction type