All categories

3 years ago

Identify the precipitation reaction in the set?

Chemistry

1 answer:

Harlamova29_29 [7]3 years ago

4 0

Answer:

The third reaction

(2NaOH + NiCL2 ---> 2NaCl + Ni(OH)2)

Explanation:

By definition, a precipitation reaction refers to the formation of an insoluble salt when two solutions containing soluble salts are combined.

(Source: lumenlearning)

From the 4 options, we can eliminate the first and second one immediately because there is no formation of an insoluble salt.

Then, the last one can also be eliminated because even though there is insoluble solid formed, but it is not a salt, and, the reactants are not solutions too. In fact, the last one is a displacement reaction. A more reactive metal displaces a less reactive metal to form an ion.

Since the third reaction matches the definition of precipitation reaction, this is the answer.

You might be interested in

Consider the following reaction at a high temperature. Br2(g) ⇆ 2Br(g) When 1.35 moles of Br2 are put in a 0.780−L flask, 3.60 p

UNO [17]

Answer : The equilibrium constant $K_c$ for the reaction is, 0.1133

Explanation :

First we have to calculate the concentration of $Br_2$ .

$\text{Concentration of }Br_2=\frac{\text{Moles of }Br_2}{\text{Volume of solution}}$

$\text{Concentration of }Br_2=\frac{1.35moles}{0.780L}=1.731M$

Now we have to calculate the dissociated concentration of $Br_2$ .

The balanced equilibrium reaction is,

$Br_2(g)\rightleftharpoons 2Br(aq)$

Initial conc. 1.731 M 0

At eqm. conc. (1.731-x) (2x) M

As we are given,

The percent of dissociation of $Br_2$ = $\alpha$ = 1.2 %

So, the dissociate concentration of $Br_2$ = $C\alpha=1.731M\times \frac{1.2}{100}=0.2077M$

The value of x = 0.2077 M

Now we have to calculate the concentration of $Br_2\text{ and }Br$ at equilibrium.

Concentration of $Br_2$ = 1.731 - x = 1.731 - 0.2077 = 1.5233 M

Concentration of $Br$ = 2x = 2 × 0.2077 = 0.4154 M

Now we have to calculate the equilibrium constant for the reaction.

The expression of equilibrium constant for the reaction will be :

$K_c=\frac{[Br]^2}{[Br_2]}$

Now put all the values in this expression, we get :

$K_c=\frac{(0.4154)^2}{1.5233}=0.1133$

Therefore, the equilibrium constant $K_c$ for the reaction is, 0.1133

7 0

3 years ago

(1 pt) You have 250.0 mL of 0.136 M HCl. Using a volumetric pipet, you take 25.00 mL of that solution, place it in a 100.00 ml v

alexdok [17]

Answer:

0.034M HCl is the concentration of the diluted solution

Explanation:

You take, initially, 25.00mL of the 0.136M HCl. Then, you dilute the solution to 100.00mL. The solution is diluted:

100.00mL / 25.00mL = 4. The solution was diluted 4 times.

That means the concentration of the diluted solution is:

0.136M / 4 =

<h3>0.034M HCl is the concentration of the diluted solution</h3>

7 0

3 years ago

What moves the pieces of salt on top of the speaker when the music is playing

Ksivusya [100]

Answer:

the friction?? or the movement

Explanation:

sense the salt is so light its easy to move

5 0

3 years ago

3. If the percent by volume is 2.0% and the volume of solution is 250 mL, what is the volume of solute in solution? (1 point) 0.

igor_vitrenko [27]

Volume percent = Volume of solute
----------------------------------
Volume of the solution

   2 Volume of the solute
------- =   ------------------------------
100 250

Volume of the solute = 2 x 250
------------
100

= 5 mL.

Hope this helps!

4 0

3 years ago

G what is the difference between the sidechains of leucine and isoleucine? select one:

statuscvo [17]

c. Isoleucine has a carbon “branched” closer to the alpha carbon than does leucine.

The structure of leucine is CH3CH(CH3)CH2CH(NH2)COOH.

The structure of isoleucine is CH3CH2CH(CH3)CH(NH2)COOH.

In leucine, the CH3 group is two carbons away from the α carbon; in isoleucine, the CH3 group is on the carbon next to the α carbon.

Thus, isoleucine has the closer branched carbon.

“One is charged, the other is not” is incorrect. Both compounds are uncharged.

“One has more H-bond acceptors than the other” is incorrect. Each acid has two H-bond acceptors — the N in the amino and the O in the carbonyl group.

“They have different numbers of carbon atoms” is incorrect. They each contain six carbon atoms.

4 0

3 years ago

Identify the precipitation reaction in the set￼?

Identify the precipitation reaction in the set?