Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
During the prophase of mitosis, the chromatin in a cell compacts to form condensed chromosomes; this condensation is required in order for the cell to divide properly. While mitotic cells have condensed chromosomes, interphase cells do not.
Explanation:
Hope it helps you
mark my answer as brainlist
have a good day
The elements in the periodice table are not listed in alphabetical order, because the arragement in rows (periods) and columns (groups or familes), in increasing order of atomic number (number of protons of the atoms) permits to explain similarities among the elements, trend in some properties, and even predict properties of unknown elements.
For example, the elements of the first group (family), called alkaline metals, all have 1 valence electron, have similar physical properties (ductibility, malleability, luster, thermal and electricity conductivity), react in similar way with water, show a trend in the atomic radii and in the ionization energy.
You can tell similar stories for other groups like, alkalyne earth metals, halogens and noble gases.
You can also tell trends in electroneativities, and atomic radii, for a row of elements, as per the order they are in the row.
So, the current array resulted very helpul for chemists to explain and predict the behavior and properties of the elements.
Answer is C.
Converting temperatures to degrees K: 33 degrees C = 306 K and -55 = 218 degrees K.
By the ideal gas law:-
760 * 0.50 / 306 = P * 0.10 / 218
P = 760 * 0.50 * 218 / 306 * 0.10
= 2700 mm Hg answer
