Answer:
Heat transfer in step 2 = 47.75 J
Explanation:
Internal energy = heat + work done
U = Q + W
In a cyclic process the total internal energy change of the system = 0.
In the process there are two steps. The total heat exchange in the process is the sum of heat exchanges in the two processes.
We have to find the heat exchange in step 2.
In step 1,
W = 1.25 J Q = -37 J
= -37 + 1.25 = -35.75 J
In step 2, the internal energy change will be negative of that in step 1.
U = 35.75 J
W = -12 J
U = Q + W
35.75 = Q -12
Q = 47.75 J
Heat transfer in step 2 = 47.75 J
It depends on the substance,but for most substance it is in the gaseous state.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Your answer→ <em>The lighter side absorbs less of the incident light, reflecting some of the energy. Darker materials also emit radiation more readily than light-colored materials, so they cool faster.</em>
Answer:
Answer A
Explanation:
because it had 6 electrons in the last shell so it needs two electrons to reach 8
