Ask question

Ask question

All categories

2 years ago

10

A student has a cube with each side is 4 cm in length, what is the volume? What is the measurement unit? Select ALL that apply.

1 answer:

Margaret [11]2 years ago

4 0

Answer:

64cm^3

Explanation:

To get the volume just multiple 4*4*4

You might be interested in

Consider the following reaction at equilibrium: 2 NH3(g) ⇄ N2(g) + 3 H2(g) What does Le Chatelier's principle predict will happe

BabaBlast [244]

Answer : The equilibrium will shift in the left direction.

Explanation :

Le-Chatelier's principle : This principle states that if any change in the variables of the reaction, the equilibrium will shift in the direction to minimize the effect.

The given reaction is:

$2NH_3(g)\rightleftharpoons N_2(g)+3H_2(g)$

As per question, when we are adding $N_2$ then the concentration of $N_2$ is increased on product side then the equilibrium will shift in the direction where decrease of concentration of $N_2$ takes place. Therefore, the equilibrium will shift in the left direction.

Thus, the equilibrium will shift in the left direction.

7 0

3 years ago

4 AlF3 + 3 O2 ----------> 2Al2O3 + 6 F2

anyanavicka [17]

Explanation:

6 F2------->4 AlF3

F2-----------> 4/6 AlF3

8.25 F2 ---------> 4×8.25/6 AlF3

so 5.5 moles

8 0

3 years ago

If 200 ml of 0.15 M propionic acid (PA) is added to 300 ml of 0.02 M NaOH, what is the resulting pH of the solution? Round the a

vodomira [7]

Answer:

pH = 4.543

Explanation:

CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
pKa = - Log Ka

∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

∴ pKa = 4.87

⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

added 300 mL 0f 0.02 M NaOH:

⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)

⇒ <em>C</em> CH3CH2COOH = 0.048 M

⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M

mass balance:

⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)

charge balance:

⇒ [H3O+] + [Na+] = [CH3CH2COO-]

∴ [Na+] = 0.02 M

⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)

(2) in (1):

⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]

replacing in Ka:

⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])

⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]

⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]

⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0

⇒ [H3O+ ] = 2.867 E-5 M

∴ pH = - Log [H3O+]

⇒ pH = 4.543

3 0

2 years ago

From Young's experiment, how does the frequency of light affect the number of lines observed?

Marina CMI [18]

Answer : (C) "Higher frequencies have larger spaces between lines".

Explanation:

In Young's experiment, the condition for constructive interference is given by :

$dsin\theta=n\lambda$ .........(1)

n is order or number of lines observed

d is distance between slits

$\theta$ is the angle between the path and the line from screen to the slits.

We also know that, $c=\nu \lambda$

or

$\lambda=\dfrac{c}{\nu}$

where,

c is the speed of light

$\nu$ is frequency

$\lambda$ is wavelength

So, equation (1) turns into

$dsin\theta=n\dfrac{c}{\nu}$

$\nu=\dfrac{n\ c}{d\ sin\theta}$

So,

$\nu\propto n$

or

Higher frequencies have larger spaces between line.

So, correct option is (C).

3 0

2 years ago

Read 2 more answers

A _______ pattern organizes a speech by incorporating repetition and variations of themes and ideas

astraxan [27]

Answer:

A wave pattern organizes a speech

8 0

2 years ago