Here is the complete question.
Benzalkonium Chloride Solution ------------> 250ml
Make solution such that when 10ml is diluted to a total volume of 1 liter a 1:200 is produced.
Sig: Dilute 10ml to a liter and apply to affected area twice daily
How many milliliters of a 17% benzalkonium chloride stock solution would be needed to prepare a liter of a 1:200 solution of benzalkonium chloride?
(A) 1700 mL
(B) 29.4 mL
(C) 17 mL
(D) 294 mL
Answer:
(B) 29.4 mL
Explanation:
1 L = 1000 mL
1:200 solution implies the
in 200 mL solution.
200 mL of solution = 1g of Benzalkonium chloride
1000 mL will be 
200mL × 1g = 1000 mL × x(g)
x(g) = 
x(g) = 0.2 g
That is to say, 0.2 g of benzalkonium chloride in 1000mL of diluted solution of 1;200 is also the amount in 10mL of the stock solution to be prepared.
∴ 
y(g) = 
y(g) = 5g of benzalkonium chloride.
Now, at 17%
concentrate contains 17g/100ml:
∴ the number of milliliters of a 17% benzalkonium chloride stock solution that is needed to prepare a liter of a 1:200 solution of benzalkonium chloride will be;
= 
z(mL) = 
z(mL) = 29.41176 mL
≅ 29.4 mL
Therefore, there are 29.4 mL of a 17% benzalkonium chloride stock solution that is required to prepare a liter of a 1:200 solution of benzalkonium chloride
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
A caption is a positively charged ion. They are formed when an ion loses one or more electrons. Typical it is the loss Of their valence electrons.
Answer:
Kb = 6.22x10⁻⁷
Explanation:
Triethanolamine, C₆H₁₅O₃N, is in equilibrium with water:
C₆H₁₅O₃N(aq) + H₂O(l) ⇄ C₆H₁₅O₃NH⁺(aq) + OH⁻(aq)
Kb is defined from concentrations in equilibrium, thus:
Kb = [C₆H₁₅O₃NH⁺] [OH⁻] / [C₆H₁₅O₃N]
The equilibrium concentration of these compounds could be written as:
[C₆H₁₅O₃N] = 0.486M - X
[C₆H₁₅O₃NH⁺] = X
[OH⁻] = X
pH is -log [H⁺], thus, [H⁺] = 10^-pH = 1.820x10⁻¹¹M
Also, Kw = [OH⁻] ₓ [H⁺];
1x10⁻¹⁴ = [OH⁻] ₓ [H⁺]
1x10⁻¹⁴ = [OH⁻] ₓ [1.820x10⁻¹¹M]
5.495x10⁻⁴M = [OH⁻], that means <em>X = 5.495x10⁻⁴M</em>
Replacing in Kb formula:
Kb = [5.495x10⁻⁴M] [5.495x10⁻⁴M] / [0.486M-5.495x10⁻⁴M]
<em>Kb = 6.22x10⁻⁷</em>
<em></em>