Hello!
The genetic material of all organisms which is made up of two twisted strands in a double helix is called DNA (DeoxyriboNucleic Acid)
DNA is the basis of all genetic information. It contains all instructions for the development and functioning of all living organisms and some viruses. The main function of DNA is the long-term storage of information to build other cell components like Proteins and RNA. It is composed of two strands with 4 possible bases which are Adenine (A), Thymine (T), Cytosine (C) and Guanine (G).
Have a nice day!
Answer is: the solution is saturated.
Solubility of potassium chloride (KCl) on 20°C is 34.2 grams in 100 grams of water, so in 200 grams of water will dissolve two times more salt (68.4 g).
Saturated solution contains the maximum concentration of a solute dissolved in the solvent (usually water) and if extra solute is add to saturated solution, that solute will not dissolve.
The amount of solute that can be dissolved in a solvent depends of chemical composition, temperature and pressure.
Answer:
Photosynthesis is endothermic while respiration is exothermic reaction.
Explanation:
Photosynthesis:
It is the process in which in the presence of sun light and chlorophyll by using carbon dioxide and water plants produce the oxygen and glucose.
Carbon dioxide + water + energy → glucose + oxygen
water is supplied through the roots, carbon dioxide collected through stomata and sun light is capture by chloroplast.
Chemical equation:
6H₂O + 6CO₂ + energy → C₆H₁₂O₆ + 6O₂
Aerobic respiration
It is the breakdown of glucose molecule in the presence of oxygen to yield large amount of energy. Water and carbon dioxide are also produced as a byproduct.
Glucose + oxygen → carbon dioxide + water + 38ATP
Anaerobic Respiration
It is the breakdown of glucose molecule in the absence of oxygen and produce small amount of energy. Alcohol or lactic acid and carbon dioxide are also produced as byproducts.
Glucose→ lactic acid/alcohol + 2ATP + carbon dioxide
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
The word problem format to the task given above is: When magnesium reacts with steam, it produces magnesium hydroxide and liberate hydrogen gas.
<h3>How magnesium hydroxide is formed?</h3>
It happens that magnesium is an alkali earth metal and react with water in the gaseous state to librate hydrogen gas, when this reaction occurs, it results in the formation of magnesium hydroxide.
The chemical equation between magnesium and water is given below:
Mg + 2H₂O -----> Mg (OH)₂ + H₂
So therefore, we can accurately deduced that magnesium hydroxide is produced when magnesium is disolved in water.
Read more on word problem:
brainly.com/question/13818690
#SPJ1