2 years ago

What is unique about obtaining water from an artesian well?

Chemistry

2 answers:

Harrizon [31]2 years ago

8 0

The third explanation is the correct answer.

Sedaia [141]2 years ago

6 0

Answer:

The water is under pressure naturally and no pump is needed.

Explanation:

You might be interested in

recommend an element use to fill bottles that contain ancient paper. the element should be a gas at room temperature, should be

Eduardwww [97]

Okay so we are given these requirements:

element which can be used to stuff bottles that enclose ancient paper
must be a gas at room temperature
must be denser than helium
must not react with other elements

The only element that comes into my mind is:

Argon

6 0

3 years ago

How are carbon-based molecules suited for sustaining life?

IrinaVladis [17]

$\huge\fcolorbox{red}{pink}{Answer ♥}$

Life on Earth is based on carbon, likely because each carbon atom can form bonds with up to four other atoms simultaneously. This quality makes carbon well-suited to form the long chains of molecules that serve as the basis for life as we know it, such as proteins and DNA.

Hope it helps uh ✌️✌️✌️

8 0

2 years ago

what is the proper scientific notation for 0.000476? a.0.476 × 10-3 b.4.76 × 10-4 c.47.6 × 10-5 d.476 × 10-6

-BARSIC- [3]

B. 4.75 × 10-4 is the answer

6 0

2 years ago

Write the equilibrium expression of each chemical equation. 2H2S(g) 2H2(g) + S2(g)

hodyreva [135]

Answer:

[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2

Explanation:

2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)

The equilibrium constant expression in terms of concentrations is:

Kc=[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2.

6 0

2 years ago

Need help answering

svp [43]

Answer:

Your answer would be E

Explanation:

4 0

2 years ago