<span>A)photosynthetic bacteria</span>
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
1.78 × 10⁹ μg
Explanation:
We have to convert 1.78 kg to μg.
Step 1: Convert 1.78 kilograms to grams
We will use the conversion factor 1 kg = 10³ g.
1.78 kg × 10³ g/1 kg = 1.78 × 10³ g
Step 2: Convert 1.78 × 10³ grams to micrograms
We will use the conversion factor 1 g = 10⁶ μg.
1.78 × 10³ g × 10⁶ μg/1 g = 1.78 × 10⁹ μg
Correct Question:
A chemist measures the enthalpy change ΔH during the following reaction: Fe(s) + 2HCl(g)-->FeCl2(s) + H2 ΔH=-157.0 kJ. Use this information to complete the table below. Round each of your answers to the nearest kJ/mol
Answer:
-314 kJ
+628 kJ
+157 kJ
Explanation:
The enthalpy change of a reaction measures the amount of heat that is lost or gained by it. If ΔH >0 the heat is gained, and the reaction is called endothermic, if ΔH<0, the heat is lost, and the reaction is called exothermic.
If the reaction is inverted, the value of ΔH is inverted too (the opposite endothermic reaction is exothermic), and if the reaction is multiplied by a constant, ΔH will be multiplied by it too.
1) 2Fe(s) + 4HCl --> 2FeCl2(s) + 2H2(g)
This reaction is the product of the given reaction by 2, so
ΔH = 2*(-157) = -314 kJ
2) 4FeCl2(s) + 4H2(g) --> 4Fe(s) + 8HCl(g)
This reaction is the inverted reaction given multiplied by 4, so
ΔH = 4*(157) = +628 kJ
3) FeCl2(s) + H2(g) --> Fe(s) + 2HCl
This reaction is the inverted reaction given, so
ΔH = +157 kJ
Vertical columns are called groups, or families.
They share similar chemical properties.
Answer: <span>have similar chemical properties</span>