I think is cells is the function
It’s a chemical reaction I guess? Or maybe it hits the water and unlike a solid and it being a liquid it goes into the water causing it to spread or something like that.
Answer:
6 moles of oxygen
Explanation:We can find from the chemistry equation
C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)
6 moles O2 ~4 moles H2O