Answer:
The pressure is 1, 22 atm.
Explanation:
We use deal gas formula. First, we convert the unit of temperature in Celsius into Kelvin. We use the constant R= 0,082 l atm /K mol.Then, we solve P (pressure).
0°C=273 K 25°C= 273 + 25= 298 K
PV=nRT -----> P= (nRT)/V
P= (0,5 mol x 0,082 l atm /K mol x 298 K)/ 10 L
<em>P= 1, 2218 atm</em>
Answer:
Distillation is the process by which sugar can be separated from the sugar solution.
Explanation:
Distillation, or classical distillation, is the process of separating the components or substances from a liquid mixture by using selective <u>boiling and condensation.</u>
Answer:
= konstanta produk kelarutan
= kation dalam larutan berair
= anion dalam larutan berair
= konsentrasi relatif a dan b
DARI WEB
Divide the mass of the compound by the mass of the solvent and then multiply by 100 g to calculate the solubility in g/100g . Solubility of NaNO3=21.9g or NaNO3 x 100 g/ 25 g =87.6. Calculate the molar mass of the dissolved compound as the sum of mass of all atoms in the molecule.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
Here's what I get
Explanation:
1. Nickel sulfate
base + acid ⟶ salt + water
NiSO₄ is a salt of the base Ni(OH)₂ and the acid sulfuric acid.
Hydroxides of transition metals are insoluble; most sulfates are soluble.
2. Carbonate + acid
Most carbonates are insoluble.
They react with acids to form carbonic acid (H₂CO₃), which decomposes into water and carbon dioxide.
