Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
D. layer B is younger than layer G.
Answer: Molar mass of 
is 17.03 g
Explanation:
Molar mass is defined as the mass in grams of 1 mole of a substance.
S.I Unit of Molar mass is gram per mole and it is represented as g/mol.
It is found by adding the atomic masses of all the elements present.
Atomic Mass of Nitrogen (N) = 14.007 g
Atomic Mass of Hydrogen (H) = 1.008 g
Molar mass of = 1(14.007)+3(1.008) g = 17.03 g
Answer:
Option D. 30 mL.
Explanation:
Step 1:
The balanced equation for the reaction. This is given below:
HNO3 + KOH —> KNO3 + H2O
From the balanced equation above,
The mole ratio of the acid, nA = 1
The mole ratio of the base, nB = 1
Step 2:
Data obtained from the question. This include the following:
Volume of base, KOH (Vb) =.?
Molarity of base, KOH (Mb) = 0.5M
Volume of acid, HNO3 (Va) = 10mL
Molarity of acid, HNO3 (Ma) = 1.5M
Step 3:
Determination of the volume of the base, KOH needed for the reaction. This can be obtained as follow:
MaVa / MbVb = nA/nB
1.5 x 10 / 0.5 x Vb = 1
Cross multiply
0.5 x Vb = 1.5 x 10
Divide both side by 0.5
Vb = (1.5 x 10) /0.5
Vb = 30mL
Therefore, the volume of the base, KOH needed for the reaction is 30mL.
