All categories

2 years ago

Which element in the list is the most reactive? C Ba S Cs

Chemistry

1 answer:

Tems11 [23]2 years ago

4 0

Answer:

Explanation:

This element is the farthest right, and lowest meaning that the reactivity of it is very high.

1. valence electrons and electronegativity

2. Both reactivity and electronegativity decrease down a group.

3. Electronegativity decreases down a group, and reactivity increases down a group.

4. The number of valence electrons increases from left to right.

5. Cs

{quizlet: captncrun}

You might be interested in

Which has a greater volume, 10 grams of water or 10 grams of acetone?

WINSTONCH [101]

Density is defined as the ratio of mass to the volume.

Density = $\frac{Mass}{Volume}$ (1)

Mass of water = 10 grams

Mass of acetone = 10 grams

Density of water = 1 $\frac{g}{cm^{3}}$

Density of acetone = 0.7857 $\frac{g}{cm^{3}}$

Put the value of density of water and its mass in equation (1)

1 $\frac{g}{cm^{3}}$ = $\frac{10 g}{volume}$

Volume of water = 10 $cm^{3}$

Put the value of density of acetone and its mass in equation (1)

0.7857 $\frac{g}{cm^{3}}$ = $\frac{10 g}{volume}$

Volume of acetone = 12.72 $cm^{3}$

Thus, volume of acetone is more than volume of water because the density of acetone is lower.

6 0

3 years ago

What are the Common compounds of niobium in which it is found

blagie [28]

Explanation:

Common Compounds of Niobium Nb

[Nb+3, Nb+5]

Compound NameFormulaMolar Mass

Niobium(III) OxideNb2O3233.811

Niobium(III) SulfateNb2(SO4)3474.0006

Niobium(V) PhosphateNb3(PO4)5753.576

Niobium(V) BromideNbBr5492.4264

Niobium(V) PentoxideNb2O5265.8098

Niobium OxychlorideNbOCl3215.2648

Niobium(V) IodideNbI5727.4287

Niobium(V) PentachlorideNbCl5270.1714

Niobium(V) ThiocyanateNb(SCN)5383.3184

Niobium(III) ChlorideNbCl3199.2654

Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259

Niobium NitrideNbN106.9131

Niobium(III) DichromateNb2(Cr2O7)3833.77676

Niobium HydroxideNb(OH)3143.9284

Niobium(V) PerchlorateNb(ClO4)5590.15938

Niobium(V) HypochloriteNb(ClO)5350.16838

Niobium(III) HypochloriteNb(ClO)3247.26358

Niobium(V) CarbonateNb2(CO3)5485.85726

Niobium(III) TartrateNb2(C4H4O6)3630.02564

Niobium(III) ChromateNb2(CrO4)3533.79386

Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356

7 0

3 years ago

Given the following: [G3P] = 1.5x10-5M; [BPG] = 3.0x10-3M ; [NAD+] = 1.2x10-5M; [NADH]=1.0x10-4 ; [HPO42-]= 1.2x10-5 M; pH = 7.5

mel-nik [20]

Answer: The given reaction is non-spontaneous in nature.

Explanation:

To calculate the $H^+$ concentration, we use the equation:

$pH=-\log[H^+]$

We are given:

pH of the solution = 7.5

$7.5=-\log [H^+]$

$[H^+]=10^{-7.5)=3.1\times 10^{-8}M$

For the given chemical equation:

$\text{Glyceraldehyde3-phosphate }+NAD^++HPO_4^{2-}\rightarrow \text{1,3-Biphosphoglycerate }+NADH+H^+$

The equation used to Gibbs free energy of the reaction follows:

$\Delta G=\Delta G^o+RT\ln K_{eq}$

where,

$\Delta G$ = free energy of the reaction

$\Delta G^o$ = standard Gibbs free energy = 6.3 kJ/mol = 6300 J/mol (Conversion factor: 1kJ = 1000J)

R = Gas constant = 8.314J/K mol

T = Temperature = $25^oC=[273+25]K=298K$

$K_{eq}$ = Ratio of concentration of products and reactants = $\frac{[BPG][NaDH][H^+]}{[G_3P][NAD^+][HPO_4^{2-}]}$

$[BPG]=3.0\times 10^{-3}M$

$[NADH]=1.0\times 10^{-4}M$

$[H^+]=3.1\times 10^{-8}M$

$[G_3P]=1.5\times 10^{-5}M$

$[NAD^+]=1.2\times 10^{-5}M$

$[HPO_4^{2-}]=1.2\times 10^{-5}M$

Putting values in above equation, we get:

$\Delta G=6300J/mol+(8.314J/K.mol\times 298K\times \ln (\frac{(3.0\times 10^{-3})\times (1.0\times 10^{-4})\times (3.1\times 10^{-8})}{(1.5\times 10^{-5})\times (1.2\times 10^{-5})\times (1.2\times 10^{-5})}))\\\\\Delta G=9917.02J/mol=9.92kJ/mol$

For the reaction to be spontaneous, the Gibbs free energy of the reaction must come out to be negative.

As, the Gibbs free energy of the reaction is positive. The reaction is said to be non-spontaneous.

Hence, the given reaction is non-spontaneous in nature.

4 0

3 years ago

Adjacent water molecules interact through the ________. a. sharing of electrons between the hydrogen of one water molecule and t

Yakvenalex [24]

Answer: Option (c) is the correct answer.

Explanation:

A water molecule is made up of two hydrogen atoms and one oxygen atom. Due to the difference in electronegativity of hydrogen and oxygen, the electrons are pulled more towards oxygen atom.

As a result, a partial positive charge will develop on hydrogen atom and a partial negative charge will develop on oxygen atom.

Thus, we can conclude that adjacent water molecules interact through the electrical attraction between the hydrogen of one water molecule and the oxygen of another water molecule.

7 0

3 years ago

Which radioactive element is used to determine the absolute age of late pleistocene animal remains?

vladimir2022 [97]

Carbon-14 is radioactive element is used to determine the absolute age of late pleistocene animal remains because it is abundant in organic matter. Its decay is first-order and its half-life has been determined to be 5730 years which means that after 5730 years, the amount of carbon−14 will be 1/2 of the initial amount.

7 0

3 years ago