The half-life of carbon-14 is about 5730 years
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
<span>Express the answer in scientific notation and with the correct number of significant figures:
(6.32 x 10-4) ÷ 12.64
5.00 x 10^-5</span>
