If you look at the periodic table of elements, you can see that atomic number for phosphorus is 15. It means that it has 15 electrons and 15 protons total. Now you can write configuration for P which is: 1s22s22p63s23p3. or [Ne] 3s2<span> 3p</span><span>3 </span><span>
From here, you can see that it has 5 valence electrons (s2+p3).
In the periodic table of elements the number of protons+ number of neutrons is determined as atomic mass. Atomic mass of the P is 30.
number of neutrons = atomic mass-atomic number
number of neutrons = 30-15
number of neutrons= 15 </span>
Using oil as energy
Hope this helps!:)
Answer: Its option "A" Both A and R are true and R is the correct explanation of A.
Hope it helps
For the answer to the question above, well presumably because the exact concentration of the composition KMnO4 solution doesn't matter. <span>If the concentration of the KMnO4 solution is important (usually in titrations etc.) then it is not allowed to use a wet bottle. The water in the bottle will dilute the KMnO4 solution and change the concentration of the said compound.</span>
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
