4 years ago

Which best explains why scientific theories grow stronger over time? (2 points)

1 answer:

3 0

One theory that explains why scientific theories grow stronger over time is because more scientists study and work on the theory. Over time as the theory is studied in greater depth it becomes more accepted.

You might be interested in

JCJJISULIJ

ANEK [815]

Parietal love
DND dnd

3 0

3 years ago

Write the equilibrium expression of each chemical equation. 2H2S(g) 2H2(g) + S2(g)

hodyreva [135]

Answer:

[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2

Explanation:

2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)

The equilibrium constant expression in terms of concentrations is:

Kc=[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2.

6 0

3 years ago

In the compound H2O, the electrons in the bonds are unequally shared between oxygen and hydrogen, forming ____. (1 point)

Aloiza [94]

polar bonds due to high difference . In electronegativity of oxygen and hydrogen.

5 0

3 years ago

Read 2 more answers

Hi, can someone help me with chemistry

Dominik [7]

Idk look it up on another website

6 0

3 years ago

A substance formed when two or more elements combine and lose their distinct properties is

hram777 [196]

Is a compound that went through a chemicAl change

7 0

3 years ago