Answer:
These three factors are required for ionization potential or ionization energy.
Explanation:
Ionization potential refers to the amount of energy which is required for the removal of outermost electron of the atom. If the atom size is big so the outermost electron is far from the nucleus and low energy is required for its removal due to lower force of attraction between nucleus and outermost electron. If the nuclear charge is higher, so the electron is tightly held by the nucleus and require more energy for its removal. Nuclear charge means number of protons present in the nucleus.
Answer:
mass of hydrogen in lake = 11.19% of 12
= 1.3428
check if question is correct or not
Explanation:
THE QUESTION:which letter in the diagram above represents a mountain range in the ocean floor
A.Letter B
B.letter D
C.letter E
D.letter F
THE ANSWER: Based on my research, none of these are truly correct, as A is actually correct. However, I would highly suggests going with B, as it resembles mountains in shape.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
