Answer:
Reaction A has higher net reaction rate
Explanation:
Data:
The reaction rates:
Reaction A:
Number of electrons per area = 2 mol/ 2 cm²
= 1 mol/ cm²
Reaction B:
Number of electrons per area = 3 mol/ 5 cm²
= 0.6 mol/cm²
Based on the calculations above, the reaction B has a higher reaction rate.
Answer:
16.2 cents
Explanation:
Given that a homeowner consumes 260 kWh of energy in July when the family is on vacation most of the time.
Where Base monthly charge of $10.00. First 100 kWh per month at 16 cents/kWh. Next 200 kWh per month at 10 cents/kWh. Over 300 kWh per month at 6 cents/kWh.
For the first 100 kWh:
16 cent × 100 = 1600 cents = 16 dollars
Since 1 dollar = 100 cents
For the remaining energy:
260 - 100 = 160 kwh
10 cents × 160 = 1600 cents = 16 dollars
The total cost = 10 + 16 + 16 = 42 dollars
Note that the base monthly of 10 dollars is added.
The cost of 260 kWh of energy consumption in July is 42 dollars
To determine the average cost per kWh for the month of July, divide the total cost by the total energy consumed.
That is, 42 / 260 = 0.1615 dollars
Convert it to cents by multiplying the result by 100.
0.1615 × 100 = 16.15 cents
Approximately 16.2 cents
Answer:
Explanation:
Reynolds number:
Reynolds number describe the type of flow.If Reynolds number is too high then flow is called turbulent flow and Reynolds is low then flow is called laminar flow .
Reynolds number is a dimensionless number.Reynolds number given is the ratio of inertia force to the viscous force.
For plate can be given as
Where ρ is the density of fluid , v is the average velocity of fluid and μ is the dynamic viscosity of fluid.
Flow on plate is a external flow .The values of Reynolds number for different flow given as
Answer:
A. Forces that act perpendicular to the surface and pull an object apart exert a tensile stress on the object.
Explanation:
Tensile stress is referred as a deforming force, in which force acts perpendicular to the surface and pull an object apart, attempting to elongate it.
The tensile stress is a type of normal stress, in which a perpendicular force creates the stress to an object’s surface.
Hence, the correct option is "A."
Answer:
The Python Code for Fibonacci Sequence is :
# Function for nth Fibonacci number
def Fibonacci(n):
if n<0:
print("Incorrect input")
# First Fibonacci number is 0
elif n==0:
return 0
# Second Fibonacci number is 1
elif n==1:
return 1
else:
return Fibonacci(n-1)+Fibonacci(n-2)
# Driver Program
print(Fibonacci(9))
Explanation:
The Fibonacci numbers are the numbers in the following integer sequence.
0, 1, 1, 2, 3, 5, 8, 13, 21, 34, 55, 89, 144, ……..
In mathematical terms, the sequence Fn of Fibonacci numbers is defined by the recurrence relation
Fn = Fn-1 + Fn-2
with seed values
F0 = 0 and F1 = 1.
