Answer: O2+6H12O6=CO2+ENERGY(ATP)
I DON'T THINK SHE IS CORRECT
Explanation:
No. Although two such atoms are essentially chemically identical (they will chemically react in the same way), they are not completely identical.
Answer:
Because a molecule, by definition, has a valence of zero
(neutral charge, stable). Also by definition, an ion has a positive
or negative charge or valence and is not stable.
Explanation:
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Consider this balanced chemical equation:
2 H2 + O2 → 2 H2O
We interpret this as “two molecules of hydrogen react with one molecule of oxygen to make two molecules of water.” The chemical equation is balanced as long as the coefficients are in the ratio 2:1:2. For instance, this chemical equation is also balanced:
100 H2 + 50 O2 → 100 H2O
This equation is not conventional—because convention says that we use the lowest ratio of coefficients—but it is balanced. So is this chemical equation:
5,000 H2 + 2,500 O2 → 5,000 H2O
Again, this is not conventional, but it is still balanced. Suppose we use a much larger number:
12.044 × 1023 H2 + 6.022 × 1023 O2 → 12.044 × 1023 H2O
These coefficients are also in the ratio of 2:1:2. But these numbers are related to the number of things in a mole: the first and last numbers are two times Avogadro’s number, while the second number is Avogadro’s number. That means that the first and last numbers represent 2 mol, while the middle number is just 1 mol. Well, why not just use the number of moles in balancing the chemical equation?
2 H2 + O2 → 2 H2O